C11H13Cl2F3N2 — CID 82832762
2,6-dichloro-4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]aniline (PubChem CID 82832762) has the molecular formula C11H13Cl2F3N2 and a molecular weight of 301.14 g/mol. Its IUPAC name is 2,6-dichloro-4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]aniline.
| Compound Name | 2,6-dichloro-4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 82832762 |
| Molecular Formula | C11H13Cl2F3N2 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2,6-dichloro-4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]aniline |
| SMILES | CCN(Cc1cc(Cl)c(N)c(Cl)c1)CC(F)(F)F |
| InChI | InChI=1S/C11H13Cl2F3N2/c1-2-18(6-11(14,15)16)5-7-3-8(12)10(17)9(13)4-7/h3-4H,2,5-6,17H2,1H3 |
| InChIKey | FIYXDXKSXHCNBQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|