C13H18Cl2N2O2 — CID 82833134
4-amino-3,5-dichloro-N-ethyl-N-(1-methoxypropan-2-yl)benzamide (PubChem CID 82833134) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.21 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-ethyl-N-(1-methoxypropan-2-yl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-ethyl-N-(1-methoxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 82833134 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 4-amino-3,5-dichloro-N-ethyl-N-(1-methoxypropan-2-yl)benzamide |
| SMILES | CCN(C(=O)c1cc(Cl)c(N)c(Cl)c1)C(C)COC |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-4-17(8(2)7-19-3)13(18)9-5-10(14)12(16)11(15)6-9/h5-6,8H,4,7,16H2,1-3H3 |
| InChIKey | RQTQYWFDUYRAIJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|