C12H15Cl2F3N2 — CID 82833187
2,6-dichloro-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]aniline (PubChem CID 82833187) has the molecular formula C12H15Cl2F3N2 and a molecular weight of 315.17 g/mol. Its IUPAC name is 2,6-dichloro-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]aniline.
| Compound Name | 2,6-dichloro-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 82833187 |
| Molecular Formula | C12H15Cl2F3N2 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2,6-dichloro-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]aniline |
| SMILES | CC(C)N(Cc1cc(Cl)c(N)c(Cl)c1)CC(F)(F)F |
| InChI | InChI=1S/C12H15Cl2F3N2/c1-7(2)19(6-12(15,16)17)5-8-3-9(13)11(18)10(14)4-8/h3-4,7H,5-6,18H2,1-2H3 |
| InChIKey | YJLJZVPJRVJRRA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|