C14H18F3NO2 — CID 82834997
N-[(5-methyloxolan-2-yl)methyl]-4-(2,2,2-trifluoroethoxy)aniline (PubChem CID 82834997) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-[(5-methyloxolan-2-yl)methyl]-4-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | N-[(5-methyloxolan-2-yl)methyl]-4-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 82834997 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[(5-methyloxolan-2-yl)methyl]-4-(2,2,2-trifluoroethoxy)aniline |
| SMILES | CC1CCC(CNc2ccc(OCC(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C14H18F3NO2/c1-10-2-5-13(20-10)8-18-11-3-6-12(7-4-11)19-9-14(15,16)17/h3-4,6-7,10,13,18H,2,5,8-9H2,1H3 |
| InChIKey | GKSCFGXBUTXWQG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|