About N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine
N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine (PubChem CID 82835254) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine.
Molecular Properties
| Compound Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine |
| PubChem CID | 82835254 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine |
| SMILES | Cc1noc(CNCC2CCC(C)O2)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-7-3-4-9(14-7)5-11-6-10-12-8(2)13-15-10/h7,9,11H,3-6H2,1-2H3 |
| InChIKey | FJTHXOWDCYSMHL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine?
The IUPAC name of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine (CID 82835254) is N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine.
What is the SMILES notation for N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine?
The canonical SMILES for N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine is Cc1noc(CNCC2CCC(C)O2)n1.
What is the InChIKey of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine?
The InChIKey is FJTHXOWDCYSMHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-7-3-4-9(14-7)5-11-6-10-12-8(2)13-15-10/h7,9,11H,3-6H2,1-2H3.
What are the key properties of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine?
N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine has a molecular weight of 211.26 g/mol, XLogP of 1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(5-methyloxolan-2-yl)methanamine is sourced from PubChem (CID 82835254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).