C13H28N2O3 — CID 82835302
N-(2-methoxyethyl)-N-(3-methoxypropyl)-1-(oxolan-2-yl)ethane-1,2-diamine (PubChem CID 82835302) has the molecular formula C13H28N2O3 and a molecular weight of 260.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-(3-methoxypropyl)-1-(oxolan-2-yl)ethane-1,2-diamine.
| Compound Name | N-(2-methoxyethyl)-N-(3-methoxypropyl)-1-(oxolan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82835302 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | N-(2-methoxyethyl)-N-(3-methoxypropyl)-1-(oxolan-2-yl)ethane-1,2-diamine |
| SMILES | COCCCN(CCOC)C(CN)C1CCCO1 |
| InChI | InChI=1S/C13H28N2O3/c1-16-8-4-6-15(7-10-17-2)12(11-14)13-5-3-9-18-13/h12-13H,3-11,14H2,1-2H3 |
| InChIKey | ZALUFTZPGSJWGT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|