About 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine
2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine (PubChem CID 82835760) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine |
| PubChem CID | 82835760 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine |
| SMILES | CC1CCC(CNCC(C)N(C)C)O1 |
| InChI | InChI=1S/C11H24N2O/c1-9(13(3)4)7-12-8-11-6-5-10(2)14-11/h9-12H,5-8H2,1-4H3 |
| InChIKey | ZPRFTBNUMZTMGR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine?
The IUPAC name of 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine (CID 82835760) is 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine.
What is the SMILES notation for 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine?
The canonical SMILES for 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine is CC1CCC(CNCC(C)N(C)C)O1.
What is the InChIKey of 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine?
The InChIKey is ZPRFTBNUMZTMGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-9(13(3)4)7-12-8-11-6-5-10(2)14-11/h9-12H,5-8H2,1-4H3.
What are the key properties of 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine?
2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine has a molecular weight of 200.33 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-dimethyl-1-N-[(5-methyloxolan-2-yl)methyl]propane-1,2-diamine is sourced from PubChem (CID 82835760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).