C14H27N3O — CID 82835938
2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(oxolan-2-yl)ethanamine (PubChem CID 82835938) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(oxolan-2-yl)ethanamine.
| Compound Name | 2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(oxolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 82835938 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(oxolan-2-yl)ethanamine |
| SMILES | NCC(C1CCCO1)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C14H27N3O/c15-10-13(14-5-3-9-18-14)17-8-7-16-6-2-1-4-12(16)11-17/h12-14H,1-11,15H2 |
| InChIKey | ZWNGWJUKAJMTEG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |