C14H22N2O3S — CID 82836544
N-ethyl-4-[(5-methyloxolan-2-yl)methylamino]benzenesulfonamide (PubChem CID 82836544) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-ethyl-4-[(5-methyloxolan-2-yl)methylamino]benzenesulfonamide.
| Compound Name | N-ethyl-4-[(5-methyloxolan-2-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 82836544 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-ethyl-4-[(5-methyloxolan-2-yl)methylamino]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(NCC2CCC(C)O2)cc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-3-16-20(17,18)14-8-5-12(6-9-14)15-10-13-7-4-11(2)19-13/h5-6,8-9,11,13,15-16H,3-4,7,10H2,1-2H3 |
| InChIKey | IZZKYWNCNMKIDR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |