About 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine
5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 82836700) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 82836700 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | NC1=NCC(C2CCCO2)N1 |
| InChI | InChI=1S/C7H13N3O/c8-7-9-4-5(10-7)6-2-1-3-11-6/h5-6H,1-4H2,(H3,8,9,10) |
| InChIKey | VMGKEWXJCNKNJP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine (CID 82836700) is 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine is NC1=NCC(C2CCCO2)N1.
What is the InChIKey of 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is VMGKEWXJCNKNJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c8-7-9-4-5(10-7)6-2-1-3-11-6/h5-6H,1-4H2,(H3,8,9,10).
What are the key properties of 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine?
5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 155.20 g/mol, XLogP of -0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxolan-2-yl)-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 82836700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).