About (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine
(5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine (PubChem CID 82838209) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine.
Molecular Properties
| Compound Name | (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine |
| PubChem CID | 82838209 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine |
| SMILES | CC1CCC(C(N)c2ncon2)O1 |
| InChI | InChI=1S/C8H13N3O2/c1-5-2-3-6(13-5)7(9)8-10-4-12-11-8/h4-7H,2-3,9H2,1H3 |
| InChIKey | ASCHCEMKYLQRDS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine?
The IUPAC name of (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine (CID 82838209) is (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine.
What is the SMILES notation for (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine?
The canonical SMILES for (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine is CC1CCC(C(N)c2ncon2)O1.
What is the InChIKey of (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine?
The InChIKey is ASCHCEMKYLQRDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-5-2-3-6(13-5)7(9)8-10-4-12-11-8/h4-7H,2-3,9H2,1H3.
What are the key properties of (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine?
(5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine has a molecular weight of 183.21 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyloxolan-2-yl)-(1,2,4-oxadiazol-3-yl)methanamine is sourced from PubChem (CID 82838209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).