About 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline
3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline (PubChem CID 82838568) has the molecular formula C16H13BrN2OS
and a molecular weight of 361.26 g/mol. Its IUPAC name is 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline.
Molecular Properties
| Compound Name | 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline |
| PubChem CID | 82838568 |
| Molecular Formula | C16H13BrN2OS |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline |
| SMILES | Nc1ccc(SCc2cc(-c3ccccc3)on2)c(Br)c1 |
| InChI | InChI=1S/C16H13BrN2OS/c17-14-8-12(18)6-7-16(14)21-10-13-9-15(20-19-13)11-4-2-1-3-5-11/h1-9H,10,18H2 |
| InChIKey | ZYUQRGYZYANVCR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline?
The IUPAC name of 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline (CID 82838568) is 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline.
What is the SMILES notation for 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline?
The canonical SMILES for 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline is Nc1ccc(SCc2cc(-c3ccccc3)on2)c(Br)c1.
What is the InChIKey of 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline?
The InChIKey is ZYUQRGYZYANVCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrN2OS/c17-14-8-12(18)6-7-16(14)21-10-13-9-15(20-19-13)11-4-2-1-3-5-11/h1-9H,10,18H2.
What are the key properties of 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline?
3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline has a molecular weight of 361.26 g/mol, XLogP of 4.98, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]aniline is sourced from PubChem (CID 82838568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).