C11H18N4O4S2 — CID 82840203
6-[4-(methylsulfonylmethylsulfonyl)piperazin-1-yl]pyridin-3-amine (PubChem CID 82840203) has the molecular formula C11H18N4O4S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 6-[4-(methylsulfonylmethylsulfonyl)piperazin-1-yl]pyridin-3-amine.
| Compound Name | 6-[4-(methylsulfonylmethylsulfonyl)piperazin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 82840203 |
| Molecular Formula | C11H18N4O4S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 6-[4-(methylsulfonylmethylsulfonyl)piperazin-1-yl]pyridin-3-amine |
| SMILES | CS(=O)(=O)CS(=O)(=O)N1CCN(c2ccc(N)cn2)CC1 |
| InChI | InChI=1S/C11H18N4O4S2/c1-20(16,17)9-21(18,19)15-6-4-14(5-7-15)11-3-2-10(12)8-13-11/h2-3,8H,4-7,9,12H2,1H3 |
| InChIKey | PTAVYUBJGBBNKF-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |