About 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid
4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid (PubChem CID 82840614) has the molecular formula C11H11Cl2N3O4
and a molecular weight of 320.13 g/mol. Its IUPAC name is 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid.
Molecular Properties
| Compound Name | 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid |
| PubChem CID | 82840614 |
| Molecular Formula | C11H11Cl2N3O4 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid |
| SMILES | CC(NC(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl)C(N)=O |
| InChI | InChI=1S/C11H11Cl2N3O4/c1-4(9(14)17)15-11(20)16-8-6(12)2-5(10(18)19)3-7(8)13/h2-4H,1H3,(H2,14,17)(H,18,19)(H2,15,16,20) |
| InChIKey | TVTNOZWUIMIDST-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid?
The IUPAC name of 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid (CID 82840614) is 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid.
What is the SMILES notation for 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid?
The canonical SMILES for 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid is CC(NC(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl)C(N)=O.
What is the InChIKey of 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid?
The InChIKey is TVTNOZWUIMIDST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2N3O4/c1-4(9(14)17)15-11(20)16-8-6(12)2-5(10(18)19)3-7(8)13/h2-4H,1H3,(H2,14,17)(H,18,19)(H2,15,16,20).
What are the key properties of 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid?
4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid has a molecular weight of 320.13 g/mol, XLogP of 1.69, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-amino-1-oxopropan-2-yl)carbamoylamino]-3,5-dichlorobenzoic acid is sourced from PubChem (CID 82840614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).