C12H11BrCl2N2S — CID 82840620
4-[[(5-bromothiophen-2-yl)methylamino]methyl]-2,6-dichloroaniline (PubChem CID 82840620) has the molecular formula C12H11BrCl2N2S and a molecular weight of 366.11 g/mol. Its IUPAC name is 4-[[(5-bromothiophen-2-yl)methylamino]methyl]-2,6-dichloroaniline.
| Compound Name | 4-[[(5-bromothiophen-2-yl)methylamino]methyl]-2,6-dichloroaniline |
|---|---|
| PubChem CID | 82840620 |
| Molecular Formula | C12H11BrCl2N2S |
| Molecular Weight | 366.11 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 4-[[(5-bromothiophen-2-yl)methylamino]methyl]-2,6-dichloroaniline |
| SMILES | Nc1c(Cl)cc(CNCc2ccc(Br)s2)cc1Cl |
| InChI | InChI=1S/C12H11BrCl2N2S/c13-11-2-1-8(18-11)6-17-5-7-3-9(14)12(16)10(15)4-7/h1-4,17H,5-6,16H2 |
| InChIKey | UECWUUXKBDEMSH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.11 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|