About 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one
4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one (PubChem CID 82840726) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one |
| PubChem CID | 82840726 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one |
| SMILES | CNc1nn(C)c(=O)n1C1CCCC1 |
| InChI | InChI=1S/C9H16N4O/c1-10-8-11-12(2)9(14)13(8)7-5-3-4-6-7/h7H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | QNPUCBGBDOMRQH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one?
The IUPAC name of 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one (CID 82840726) is 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one.
What is the SMILES notation for 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one?
The canonical SMILES for 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one is CNc1nn(C)c(=O)n1C1CCCC1.
What is the InChIKey of 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one?
The InChIKey is QNPUCBGBDOMRQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-10-8-11-12(2)9(14)13(8)7-5-3-4-6-7/h7H,3-6H2,1-2H3,(H,10,11).
What are the key properties of 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one?
4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one has a molecular weight of 196.25 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-2-methyl-5-(methylamino)-1,2,4-triazol-3-one is sourced from PubChem (CID 82840726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).