C10H9BrF3NO2S — CID 82841964
2-[(4-amino-2-bromophenyl)sulfanylmethyl]-3,3,3-trifluoropropanoic acid (PubChem CID 82841964) has the molecular formula C10H9BrF3NO2S and a molecular weight of 344.15 g/mol. Its IUPAC name is 2-[(4-amino-2-bromophenyl)sulfanylmethyl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[(4-amino-2-bromophenyl)sulfanylmethyl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 82841964 |
| Molecular Formula | C10H9BrF3NO2S |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | 2-[(4-amino-2-bromophenyl)sulfanylmethyl]-3,3,3-trifluoropropanoic acid |
| SMILES | Nc1ccc(SCC(C(=O)O)C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C10H9BrF3NO2S/c11-7-3-5(15)1-2-8(7)18-4-6(9(16)17)10(12,13)14/h1-3,6H,4,15H2,(H,16,17) |
| InChIKey | ZCOKFJVLYIFRCZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|