C8H15NO5S2 — CID 82842599
1-(methylsulfonylmethylsulfonyl)piperidine-4-carbaldehyde (PubChem CID 82842599) has the molecular formula C8H15NO5S2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-(methylsulfonylmethylsulfonyl)piperidine-4-carbaldehyde.
| Compound Name | 1-(methylsulfonylmethylsulfonyl)piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 82842599 |
| Molecular Formula | C8H15NO5S2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 1-(methylsulfonylmethylsulfonyl)piperidine-4-carbaldehyde |
| SMILES | CS(=O)(=O)CS(=O)(=O)N1CCC(C=O)CC1 |
| InChI | InChI=1S/C8H15NO5S2/c1-15(11,12)7-16(13,14)9-4-2-8(6-10)3-5-9/h6,8H,2-5,7H2,1H3 |
| InChIKey | VDROJGQHESZJQH-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|