C8H17NO5S2 — CID 82843046
N-[(2-hydroxycyclopentyl)methyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 82843046) has the molecular formula C8H17NO5S2 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[(2-hydroxycyclopentyl)methyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[(2-hydroxycyclopentyl)methyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82843046 |
| Molecular Formula | C8H17NO5S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | N-[(2-hydroxycyclopentyl)methyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)NCC1CCCC1O |
| InChI | InChI=1S/C8H17NO5S2/c1-15(11,12)6-16(13,14)9-5-7-3-2-4-8(7)10/h7-10H,2-6H2,1H3 |
| InChIKey | QPLSXANEEXUFAO-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |