C10H20N2O4S2 — CID 82843054
(3aR,7aS)-2-(methylsulfonylmethylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 82843054) has the molecular formula C10H20N2O4S2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3aR,7aS)-2-(methylsulfonylmethylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-(methylsulfonylmethylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 82843054 |
| Molecular Formula | C10H20N2O4S2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (3aR,7aS)-2-(methylsulfonylmethylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | CS(=O)(=O)CS(=O)(=O)N1C[C@H]2CCC(N)C[C@H]2C1 |
| InChI | InChI=1S/C10H20N2O4S2/c1-17(13,14)7-18(15,16)12-5-8-2-3-10(11)4-9(8)6-12/h8-10H,2-7,11H2,1H3/t8-,9+,10?/m1/s1 |
| InChIKey | DSRAPDHDTWNKMO-ZDGBYWQASA-N |
| XLogP | -0.62 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |