C8H19N3O6S2 — CID 82843075
N'-hydroxy-3-[2-methoxyethyl(methylsulfonylmethylsulfonyl)amino]propanimidamide (PubChem CID 82843075) has the molecular formula C8H19N3O6S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is N'-hydroxy-3-[2-methoxyethyl(methylsulfonylmethylsulfonyl)amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[2-methoxyethyl(methylsulfonylmethylsulfonyl)amino]propanimidamide |
|---|---|
| PubChem CID | 82843075 |
| Molecular Formula | C8H19N3O6S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N'-hydroxy-3-[2-methoxyethyl(methylsulfonylmethylsulfonyl)amino]propanimidamide |
| SMILES | COCCN(CCC(N)=NO)S(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C8H19N3O6S2/c1-17-6-5-11(4-3-8(9)10-12)19(15,16)7-18(2,13)14/h12H,3-7H2,1-2H3,(H2,9,10) |
| InChIKey | QORZTWJLSYPYLH-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|