C11H17NO4 — CID 82843216
3-[2-(aminomethyl)-4-methoxyphenoxy]propane-1,2-diol (PubChem CID 82843216) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-4-methoxyphenoxy]propane-1,2-diol.
| Compound Name | 3-[2-(aminomethyl)-4-methoxyphenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 82843216 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-[2-(aminomethyl)-4-methoxyphenoxy]propane-1,2-diol |
| SMILES | COc1ccc(OCC(O)CO)c(CN)c1 |
| InChI | InChI=1S/C11H17NO4/c1-15-10-2-3-11(8(4-10)5-12)16-7-9(14)6-13/h2-4,9,13-14H,5-7,12H2,1H3 |
| InChIKey | ONDQHNDWZNFUII-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |