C8H16N2O4S2 — CID 82843470
5-(methylsulfonylmethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 82843470) has the molecular formula C8H16N2O4S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-(methylsulfonylmethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(methylsulfonylmethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 82843470 |
| Molecular Formula | C8H16N2O4S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-(methylsulfonylmethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CS(=O)(=O)CS(=O)(=O)N1CC2CNCC2C1 |
| InChI | InChI=1S/C8H16N2O4S2/c1-15(11,12)6-16(13,14)10-4-7-2-9-3-8(7)5-10/h7-9H,2-6H2,1H3 |
| InChIKey | VULXEYTXOMOPNW-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |