About 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid
5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid (PubChem CID 82845398) has the molecular formula C11H17N3O3S
and a molecular weight of 271.34 g/mol. Its IUPAC name is 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid.
Molecular Properties
| Compound Name | 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid |
| PubChem CID | 82845398 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid |
| SMILES | Cc1nc(N)sc1C(=O)NC(C)CCCC(=O)O |
| InChI | InChI=1S/C11H17N3O3S/c1-6(4-3-5-8(15)16)13-10(17)9-7(2)14-11(12)18-9/h6H,3-5H2,1-2H3,(H2,12,14)(H,13,17)(H,15,16) |
| InChIKey | HMUNIEDEOAQXTG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid?
The IUPAC name of 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid (CID 82845398) is 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid.
What is the SMILES notation for 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid?
The canonical SMILES for 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid is Cc1nc(N)sc1C(=O)NC(C)CCCC(=O)O.
What is the InChIKey of 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid?
The InChIKey is HMUNIEDEOAQXTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3S/c1-6(4-3-5-8(15)16)13-10(17)9-7(2)14-11(12)18-9/h6H,3-5H2,1-2H3,(H2,12,14)(H,13,17)(H,15,16).
What are the key properties of 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid?
5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid has a molecular weight of 271.34 g/mol, XLogP of 1.41, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)amino]hexanoic acid is sourced from PubChem (CID 82845398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).