C16H20N2O3 — CID 82845531
5-[(2-methyl-1H-indole-3-carbonyl)amino]hexanoic acid (PubChem CID 82845531) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-[(2-methyl-1H-indole-3-carbonyl)amino]hexanoic acid.
| Compound Name | 5-[(2-methyl-1H-indole-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 82845531 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 5-[(2-methyl-1H-indole-3-carbonyl)amino]hexanoic acid |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)NC(C)CCCC(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-10(6-5-9-14(19)20)17-16(21)15-11(2)18-13-8-4-3-7-12(13)15/h3-4,7-8,10,18H,5-6,9H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | DBIGQUVRDMTOQV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |