C11H15F2N3O4S — CID 82845650
N-(2,2-difluoroethyl)-4-nitro-3-(propylamino)benzenesulfonamide (PubChem CID 82845650) has the molecular formula C11H15F2N3O4S and a molecular weight of 323.32 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-4-nitro-3-(propylamino)benzenesulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-4-nitro-3-(propylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 82845650 |
| Molecular Formula | C11H15F2N3O4S |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-(2,2-difluoroethyl)-4-nitro-3-(propylamino)benzenesulfonamide |
| SMILES | CCCNc1cc(S(=O)(=O)NCC(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15F2N3O4S/c1-2-5-14-9-6-8(3-4-10(9)16(17)18)21(19,20)15-7-11(12)13/h3-4,6,11,14-15H,2,5,7H2,1H3 |
| InChIKey | LXGYKPQAKSFRFO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|