C14H19ClN2O3 — CID 82847981
5-amino-N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)hexanamide (PubChem CID 82847981) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-amino-N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)hexanamide.
| Compound Name | 5-amino-N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)hexanamide |
|---|---|
| PubChem CID | 82847981 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-amino-N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)hexanamide |
| SMILES | CC(N)CCCC(=O)Nc1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C14H19ClN2O3/c1-9(16)3-2-4-14(18)17-11-8-13-12(7-10(11)15)19-5-6-20-13/h7-9H,2-6,16H2,1H3,(H,17,18) |
| InChIKey | GCTNJNXIMKJOIW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |