C11H16O4 — CID 82849501
3-[3-[(1S)-1-hydroxyethyl]phenoxy]propane-1,2-diol (PubChem CID 82849501) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 3-[3-[(1S)-1-hydroxyethyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[3-[(1S)-1-hydroxyethyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 82849501 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-[3-[(1S)-1-hydroxyethyl]phenoxy]propane-1,2-diol |
| SMILES | C[C@H](O)c1cccc(OCC(O)CO)c1 |
| InChI | InChI=1S/C11H16O4/c1-8(13)9-3-2-4-11(5-9)15-7-10(14)6-12/h2-5,8,10,12-14H,6-7H2,1H3/t8-,10?/m0/s1 |
| InChIKey | AWLQQQNSOZBJQB-PEHGTWAWSA-N |
| XLogP | 0.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |