About 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide
1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide (PubChem CID 82849638) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide |
| PubChem CID | 82849638 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide |
| SMILES | CC1CCC(C(N)=O)CN1CC(O)CO |
| InChI | InChI=1S/C10H20N2O3/c1-7-2-3-8(10(11)15)4-12(7)5-9(14)6-13/h7-9,13-14H,2-6H2,1H3,(H2,11,15) |
| InChIKey | GWDLSYROXZMDOQ-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide?
The IUPAC name of 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide (CID 82849638) is 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide.
What is the SMILES notation for 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide?
The canonical SMILES for 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide is CC1CCC(C(N)=O)CN1CC(O)CO.
What is the InChIKey of 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide?
The InChIKey is GWDLSYROXZMDOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-7-2-3-8(10(11)15)4-12(7)5-9(14)6-13/h7-9,13-14H,2-6H2,1H3,(H2,11,15).
What are the key properties of 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide?
1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide has a molecular weight of 216.28 g/mol, XLogP of -1.07, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydroxypropyl)-6-methylpiperidine-3-carboxamide is sourced from PubChem (CID 82849638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).