C7H11N3O4 — CID 82849645
3-(4-methyl-3-nitropyrazol-1-yl)propane-1,2-diol (PubChem CID 82849645) has the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. Its IUPAC name is 3-(4-methyl-3-nitropyrazol-1-yl)propane-1,2-diol.
| Compound Name | 3-(4-methyl-3-nitropyrazol-1-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 82849645 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 3-(4-methyl-3-nitropyrazol-1-yl)propane-1,2-diol |
| SMILES | Cc1cn(CC(O)CO)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N3O4/c1-5-2-9(3-6(12)4-11)8-7(5)10(13)14/h2,6,11-12H,3-4H2,1H3 |
| InChIKey | CPNHMYYIFWKDLX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|