C11H10BrNO4 — CID 82850176
7-bromo-1-(2,3-dihydroxypropyl)indole-2,3-dione (PubChem CID 82850176) has the molecular formula C11H10BrNO4 and a molecular weight of 300.11 g/mol. Its IUPAC name is 7-bromo-1-(2,3-dihydroxypropyl)indole-2,3-dione.
| Compound Name | 7-bromo-1-(2,3-dihydroxypropyl)indole-2,3-dione |
|---|---|
| PubChem CID | 82850176 |
| Molecular Formula | C11H10BrNO4 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 7-bromo-1-(2,3-dihydroxypropyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC(O)CO)c2c(Br)cccc21 |
| InChI | InChI=1S/C11H10BrNO4/c12-8-3-1-2-7-9(8)13(4-6(15)5-14)11(17)10(7)16/h1-3,6,14-15H,4-5H2 |
| InChIKey | RTOQUGPPBGNXOC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|