About 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol
3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol (PubChem CID 82850214) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol |
| PubChem CID | 82850214 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol |
| SMILES | CC1CN(CC(O)CO)C(C)CN1 |
| InChI | InChI=1S/C9H20N2O2/c1-7-4-11(5-9(13)6-12)8(2)3-10-7/h7-10,12-13H,3-6H2,1-2H3 |
| InChIKey | DSCNOZJJNMKWJN-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol?
The IUPAC name of 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol (CID 82850214) is 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol.
What is the SMILES notation for 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol?
The canonical SMILES for 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol is CC1CN(CC(O)CO)C(C)CN1.
What is the InChIKey of 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol?
The InChIKey is DSCNOZJJNMKWJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-7-4-11(5-9(13)6-12)8(2)3-10-7/h7-10,12-13H,3-6H2,1-2H3.
What are the key properties of 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol?
3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol has a molecular weight of 188.27 g/mol, XLogP of -0.98, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylpiperazin-1-yl)propane-1,2-diol is sourced from PubChem (CID 82850214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).