About 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one
5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one (PubChem CID 82850343) has the molecular formula C8H11BrN2O3
and a molecular weight of 263.09 g/mol. Its IUPAC name is 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one |
| PubChem CID | 82850343 |
| Molecular Formula | C8H11BrN2O3 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one |
| SMILES | Cc1ncn(CC(O)CO)c(=O)c1Br |
| InChI | InChI=1S/C8H11BrN2O3/c1-5-7(9)8(14)11(4-10-5)2-6(13)3-12/h4,6,12-13H,2-3H2,1H3 |
| InChIKey | DDUIJGVUUQDIBE-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one?
The IUPAC name of 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one (CID 82850343) is 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one.
What is the SMILES notation for 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one?
The canonical SMILES for 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one is Cc1ncn(CC(O)CO)c(=O)c1Br.
What is the InChIKey of 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one?
The InChIKey is DDUIJGVUUQDIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2O3/c1-5-7(9)8(14)11(4-10-5)2-6(13)3-12/h4,6,12-13H,2-3H2,1H3.
What are the key properties of 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one?
5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one has a molecular weight of 263.09 g/mol, XLogP of -0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(2,3-dihydroxypropyl)-6-methylpyrimidin-4-one is sourced from PubChem (CID 82850343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).