About 2-(2,3-dihydroxypropyl)pyridazin-3-one
2-(2,3-dihydroxypropyl)pyridazin-3-one (PubChem CID 82850469) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 2-(2,3-dihydroxypropyl)pyridazin-3-one |
| PubChem CID | 82850469 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)pyridazin-3-one |
| SMILES | O=c1cccnn1CC(O)CO |
| InChI | InChI=1S/C7H10N2O3/c10-5-6(11)4-9-7(12)2-1-3-8-9/h1-3,6,10-11H,4-5H2 |
| InChIKey | HWTWSACFQJIFQE-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,3-dihydroxypropyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydroxypropyl)pyridazin-3-one?
The IUPAC name of 2-(2,3-dihydroxypropyl)pyridazin-3-one (CID 82850469) is 2-(2,3-dihydroxypropyl)pyridazin-3-one.
What is the SMILES notation for 2-(2,3-dihydroxypropyl)pyridazin-3-one?
The canonical SMILES for 2-(2,3-dihydroxypropyl)pyridazin-3-one is O=c1cccnn1CC(O)CO.
What is the InChIKey of 2-(2,3-dihydroxypropyl)pyridazin-3-one?
The InChIKey is HWTWSACFQJIFQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c10-5-6(11)4-9-7(12)2-1-3-8-9/h1-3,6,10-11H,4-5H2.
What are the key properties of 2-(2,3-dihydroxypropyl)pyridazin-3-one?
2-(2,3-dihydroxypropyl)pyridazin-3-one has a molecular weight of 170.17 g/mol, XLogP of -1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroxypropyl)pyridazin-3-one is sourced from PubChem (CID 82850469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).