About 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one
3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one (PubChem CID 82850470) has the molecular formula C7H9IN2O3
and a molecular weight of 296.06 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one |
| PubChem CID | 82850470 |
| Molecular Formula | C7H9IN2O3 |
| Molecular Weight | 296.06 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one |
| SMILES | O=c1c(I)cncn1CC(O)CO |
| InChI | InChI=1S/C7H9IN2O3/c8-6-1-9-4-10(7(6)13)2-5(12)3-11/h1,4-5,11-12H,2-3H2 |
| InChIKey | IHLBCSNPCFIECZ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.06 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one?
The IUPAC name of 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one (CID 82850470) is 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one.
What is the SMILES notation for 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one?
The canonical SMILES for 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one is O=c1c(I)cncn1CC(O)CO.
What is the InChIKey of 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one?
The InChIKey is IHLBCSNPCFIECZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9IN2O3/c8-6-1-9-4-10(7(6)13)2-5(12)3-11/h1,4-5,11-12H,2-3H2.
What are the key properties of 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one?
3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one has a molecular weight of 296.06 g/mol, XLogP of -0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroxypropyl)-5-iodopyrimidin-4-one is sourced from PubChem (CID 82850470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).