C15H25NO3 — CID 82850496
3-[4-[1-(propylamino)propyl]phenoxy]propane-1,2-diol (PubChem CID 82850496) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-[4-[1-(propylamino)propyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[1-(propylamino)propyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 82850496 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 3-[4-[1-(propylamino)propyl]phenoxy]propane-1,2-diol |
| SMILES | CCCNC(CC)c1ccc(OCC(O)CO)cc1 |
| InChI | InChI=1S/C15H25NO3/c1-3-9-16-15(4-2)12-5-7-14(8-6-12)19-11-13(18)10-17/h5-8,13,15-18H,3-4,9-11H2,1-2H3 |
| InChIKey | VKGGTPMEJBKDIC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |