C10H10N2O7S — CID 82850585
2-(2,3-dihydroxypropyl)-5-nitro-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 82850585) has the molecular formula C10H10N2O7S and a molecular weight of 302.26 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)-5-nitro-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(2,3-dihydroxypropyl)-5-nitro-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 82850585 |
| Molecular Formula | C10H10N2O7S |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)-5-nitro-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2S(=O)(=O)N1CC(O)CO |
| InChI | InChI=1S/C10H10N2O7S/c13-5-7(14)4-11-10(15)8-3-6(12(16)17)1-2-9(8)20(11,18)19/h1-3,7,13-14H,4-5H2 |
| InChIKey | OICNFXRQOYZMJQ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|