About 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid
1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid (PubChem CID 82851071) has the molecular formula C7H10N2O4
and a molecular weight of 186.17 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid |
| PubChem CID | 82851071 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(CC(O)CO)n1 |
| InChI | InChI=1S/C7H10N2O4/c10-4-5(11)3-9-2-1-6(8-9)7(12)13/h1-2,5,10-11H,3-4H2,(H,12,13) |
| InChIKey | AVRFKKDOCFSZSY-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid?
The IUPAC name of 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid (CID 82851071) is 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid.
What is the SMILES notation for 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid?
The canonical SMILES for 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid is O=C(O)c1ccn(CC(O)CO)n1.
What is the InChIKey of 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid?
The InChIKey is AVRFKKDOCFSZSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c10-4-5(11)3-9-2-1-6(8-9)7(12)13/h1-2,5,10-11H,3-4H2,(H,12,13).
What are the key properties of 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid?
1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid has a molecular weight of 186.17 g/mol, XLogP of -1.07, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydroxypropyl)pyrazole-3-carboxylic acid is sourced from PubChem (CID 82851071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).