About 7,8-dihydroxyoctan-4-one
7,8-dihydroxyoctan-4-one (PubChem CID 82851073) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 7,8-dihydroxyoctan-4-one.
Molecular Properties
| Compound Name | 7,8-dihydroxyoctan-4-one |
| PubChem CID | 82851073 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 7,8-dihydroxyoctan-4-one |
| SMILES | CCCC(=O)CCC(O)CO |
| InChI | InChI=1S/C8H16O3/c1-2-3-7(10)4-5-8(11)6-9/h8-9,11H,2-6H2,1H3 |
| InChIKey | UXHUPUYHSZZXGY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dihydroxyoctan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydroxyoctan-4-one?
The IUPAC name of 7,8-dihydroxyoctan-4-one (CID 82851073) is 7,8-dihydroxyoctan-4-one.
What is the SMILES notation for 7,8-dihydroxyoctan-4-one?
The canonical SMILES for 7,8-dihydroxyoctan-4-one is CCCC(=O)CCC(O)CO.
What is the InChIKey of 7,8-dihydroxyoctan-4-one?
The InChIKey is UXHUPUYHSZZXGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-2-3-7(10)4-5-8(11)6-9/h8-9,11H,2-6H2,1H3.
What are the key properties of 7,8-dihydroxyoctan-4-one?
7,8-dihydroxyoctan-4-one has a molecular weight of 160.21 g/mol, XLogP of 0.49, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydroxyoctan-4-one is sourced from PubChem (CID 82851073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).