C11H23NO2 — CID 82851087
3-[cyclohexylmethyl(methyl)amino]propane-1,2-diol (PubChem CID 82851087) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-[cyclohexylmethyl(methyl)amino]propane-1,2-diol.
| Compound Name | 3-[cyclohexylmethyl(methyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 82851087 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 3-[cyclohexylmethyl(methyl)amino]propane-1,2-diol |
| SMILES | CN(CC(O)CO)CC1CCCCC1 |
| InChI | InChI=1S/C11H23NO2/c1-12(8-11(14)9-13)7-10-5-3-2-4-6-10/h10-11,13-14H,2-9H2,1H3 |
| InChIKey | YTXQJMPEWCXEOS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |