About 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one
5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one (PubChem CID 82851093) has the molecular formula C9H13BrN2O3
and a molecular weight of 277.12 g/mol. Its IUPAC name is 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one.
Molecular Properties
| Compound Name | 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one |
| PubChem CID | 82851093 |
| Molecular Formula | C9H13BrN2O3 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one |
| SMILES | Cc1nc(=O)n(CC(O)CO)c(C)c1Br |
| InChI | InChI=1S/C9H13BrN2O3/c1-5-8(10)6(2)12(9(15)11-5)3-7(14)4-13/h7,13-14H,3-4H2,1-2H3 |
| InChIKey | RRXULLINASNTNM-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one?
The IUPAC name of 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one (CID 82851093) is 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one.
What is the SMILES notation for 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one?
The canonical SMILES for 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one is Cc1nc(=O)n(CC(O)CO)c(C)c1Br.
What is the InChIKey of 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one?
The InChIKey is RRXULLINASNTNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN2O3/c1-5-8(10)6(2)12(9(15)11-5)3-7(14)4-13/h7,13-14H,3-4H2,1-2H3.
What are the key properties of 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one?
5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one has a molecular weight of 277.12 g/mol, XLogP of -0.02, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-(2,3-dihydroxypropyl)-4,6-dimethylpyrimidin-2-one is sourced from PubChem (CID 82851093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).