C11H20N2O2 — CID 82851108
3-[3-(1-aminobutyl)pyrrol-1-yl]propane-1,2-diol (PubChem CID 82851108) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-[3-(1-aminobutyl)pyrrol-1-yl]propane-1,2-diol.
| Compound Name | 3-[3-(1-aminobutyl)pyrrol-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 82851108 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 3-[3-(1-aminobutyl)pyrrol-1-yl]propane-1,2-diol |
| SMILES | CCCC(N)c1ccn(CC(O)CO)c1 |
| InChI | InChI=1S/C11H20N2O2/c1-2-3-11(12)9-4-5-13(6-9)7-10(15)8-14/h4-6,10-11,14-15H,2-3,7-8,12H2,1H3 |
| InChIKey | YZVFBYOYIJBTJN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |