About 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione
4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione (PubChem CID 82851176) has the molecular formula C11H9ClFNO4
and a molecular weight of 273.65 g/mol. Its IUPAC name is 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione.
Molecular Properties
| Compound Name | 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione |
| PubChem CID | 82851176 |
| Molecular Formula | C11H9ClFNO4 |
| Molecular Weight | 273.65 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione |
| SMILES | O=C1C(=O)N(CC(O)CO)c2c(F)ccc(Cl)c21 |
| InChI | InChI=1S/C11H9ClFNO4/c12-6-1-2-7(13)9-8(6)10(17)11(18)14(9)3-5(16)4-15/h1-2,5,15-16H,3-4H2 |
| InChIKey | BSOUMDLWQBNKLX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.65 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione?
The IUPAC name of 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione (CID 82851176) is 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione.
What is the SMILES notation for 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione?
The canonical SMILES for 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione is O=C1C(=O)N(CC(O)CO)c2c(F)ccc(Cl)c21.
What is the InChIKey of 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione?
The InChIKey is BSOUMDLWQBNKLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClFNO4/c12-6-1-2-7(13)9-8(6)10(17)11(18)14(9)3-5(16)4-15/h1-2,5,15-16H,3-4H2.
What are the key properties of 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione?
4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione has a molecular weight of 273.65 g/mol, XLogP of 0.36, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-(2,3-dihydroxypropyl)-7-fluoroindole-2,3-dione is sourced from PubChem (CID 82851176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).