C16H23FN2 — CID 82852969
N-[(4-fluoro-3,5-dimethylphenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine (PubChem CID 82852969) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is N-[(4-fluoro-3,5-dimethylphenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine.
| Compound Name | N-[(4-fluoro-3,5-dimethylphenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
|---|---|
| PubChem CID | 82852969 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-[(4-fluoro-3,5-dimethylphenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
| SMILES | Cc1cc(CNC2CCN3CCCC23)cc(C)c1F |
| InChI | InChI=1S/C16H23FN2/c1-11-8-13(9-12(2)16(11)17)10-18-14-5-7-19-6-3-4-15(14)19/h8-9,14-15,18H,3-7,10H2,1-2H3 |
| InChIKey | XOQSKXCXSOQAIE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |