C14H24N4S — CID 82853076
1-(aminomethyl)-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,5,6,7,8-hexahydropyrrolizin-1-amine (PubChem CID 82853076) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is 1-(aminomethyl)-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,5,6,7,8-hexahydropyrrolizin-1-amine.
| Compound Name | 1-(aminomethyl)-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,5,6,7,8-hexahydropyrrolizin-1-amine |
|---|---|
| PubChem CID | 82853076 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-(aminomethyl)-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,5,6,7,8-hexahydropyrrolizin-1-amine |
| SMILES | Cc1ncsc1CN(C)C1(CN)CCN2CCCC21 |
| InChI | InChI=1S/C14H24N4S/c1-11-12(19-10-16-11)8-17(2)14(9-15)5-7-18-6-3-4-13(14)18/h10,13H,3-9,15H2,1-2H3 |
| InChIKey | IWGQKLWGLFSSLW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |