C15H28N2O2 — CID 82853110
N-[3-(oxolan-2-ylmethoxy)propyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine (PubChem CID 82853110) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[3-(oxolan-2-ylmethoxy)propyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine.
| Compound Name | N-[3-(oxolan-2-ylmethoxy)propyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
|---|---|
| PubChem CID | 82853110 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | N-[3-(oxolan-2-ylmethoxy)propyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
| SMILES | C(CNC1CCN2CCCC12)COCC1CCCO1 |
| InChI | InChI=1S/C15H28N2O2/c1-5-15-14(6-9-17(15)8-1)16-7-3-10-18-12-13-4-2-11-19-13/h13-16H,1-12H2 |
| InChIKey | ZRQMGKWSYBQBCP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|