C10H13NO3 — CID 82855479
spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,3'-oxolane]-2',5'-dione (PubChem CID 82855479) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,3'-oxolane]-2',5'-dione.
| Compound Name | spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,3'-oxolane]-2',5'-dione |
|---|---|
| PubChem CID | 82855479 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,3'-oxolane]-2',5'-dione |
| SMILES | O=C1CC2(CCN3CCCC32)C(=O)O1 |
| InChI | InChI=1S/C10H13NO3/c12-8-6-10(9(13)14-8)3-5-11-4-1-2-7(10)11/h7H,1-6H2 |
| InChIKey | GNFHTXSZWHMRDR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|