C11H19NO — CID 82855626
1-(2-methylprop-1-enyl)-2,3,5,6,7,8-hexahydropyrrolizin-1-ol (PubChem CID 82855626) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(2-methylprop-1-enyl)-2,3,5,6,7,8-hexahydropyrrolizin-1-ol.
| Compound Name | 1-(2-methylprop-1-enyl)-2,3,5,6,7,8-hexahydropyrrolizin-1-ol |
|---|---|
| PubChem CID | 82855626 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-(2-methylprop-1-enyl)-2,3,5,6,7,8-hexahydropyrrolizin-1-ol |
| SMILES | CC(C)=CC1(O)CCN2CCCC21 |
| InChI | InChI=1S/C11H19NO/c1-9(2)8-11(13)5-7-12-6-3-4-10(11)12/h8,10,13H,3-7H2,1-2H3 |
| InChIKey | SFUQOBJBXVDHCM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|