C12H22N2O3S — CID 82855670
1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-2,3,5,6,7,8-hexahydropyrrolizin-1-ol (PubChem CID 82855670) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-2,3,5,6,7,8-hexahydropyrrolizin-1-ol.
| Compound Name | 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-2,3,5,6,7,8-hexahydropyrrolizin-1-ol |
|---|---|
| PubChem CID | 82855670 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-2,3,5,6,7,8-hexahydropyrrolizin-1-ol |
| SMILES | NCC1(C2(O)CCN3CCCC32)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H22N2O3S/c13-8-11(4-7-18(16,17)9-11)12(15)3-6-14-5-1-2-10(12)14/h10,15H,1-9,13H2 |
| InChIKey | HNDFSSYYPMWRSS-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |