C14H23NO5 — CID 82856130
diethyl 2-(1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl)propanedioate (PubChem CID 82856130) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is diethyl 2-(1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl)propanedioate.
| Compound Name | diethyl 2-(1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl)propanedioate |
|---|---|
| PubChem CID | 82856130 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | diethyl 2-(1-hydroxy-2,3,5,6,7,8-hexahydropyrrolizin-1-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1(O)CCN2CCCC21 |
| InChI | InChI=1S/C14H23NO5/c1-3-19-12(16)11(13(17)20-4-2)14(18)7-9-15-8-5-6-10(14)15/h10-11,18H,3-9H2,1-2H3 |
| InChIKey | QVNRMABKIDDMSV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|